Chlorotrianisene,CAS#569-57-3
CAS # 569-57-3, Chlorotrianisene
Name
Chlorotrianisene
Synonyms
1-[2-Chloro-1,2-Bis(4-Methoxyphenyl)Vinyl]-4-Methoxy-Benzene; 1-[2-Chloro-1,2-Bis(4-Methoxyphenyl)Vinyl]-4-Methoxybenzene; 1-[2-Chloro-1,2-Bis(4-Methoxyphenyl)Ethenyl]-4-Methoxy-Benzene
Molecular Formula
C23H21ClO3
Molecular Weight 380.87
CAS Registry Number
569-57-3
EINECS 209-318-6
SMILES
C3=C(C(C1=CC=C(OC)C=C1)=C(C2=CC=C(C=C2)OC)Cl)C=CC(=C3)OC
InChI
1S/C23H21ClO3/c1-25-19-10-4-16(5-11-19)22(17-6-12-20(26-2)13-7-17)23(24)18-8-14-21(27-3)15-9-18/h4-15H,1-3H3
InChIKey BFPSDSIWYFKGBC-UHFFFAOYSA-N