4-(2-Oxiranylmethoxy)-Benzeneacetamide,CAS#29122-69-8
CAS # 29122-69-8, 4-(2-Oxiranylmethoxy)-Benzeneacetamide
Name
4-(2-Oxiranylmethoxy)-Benzeneacetamide
Synonyms
2-[4-(2-Oxiranylmethoxy)Phenyl]Acetamide; 2-(4-Glycidoxyphenyl)Acetamide; 2-[4-(Oxiran-2-Ylmethoxy)Phenyl]Ethanamide
Molecular Formula
C11H13NO3
Molecular Weight 207.23
CAS Registry Number
29122-69-8
EINECS 249-452-2
SMILES
C2=C(OCC1OC1)C=CC(=C2)CC(=O)N
InChI
1S/C11H13NO3/c12-11(13)5-8-1-3-9(4-2-8)14-6-10-7-15-10/h1-4,10H,5-7H2,(H2,12,13)
InChIKey SOGKXLVYZZXFTN-UHFFFAOYSA-N